C29H44O3S — CID 131966530
(1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-5-butylsulfonylhex-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 131966530) has the molecular formula C29H44O3S and a molecular weight of 472.74 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-5-butylsulfonylhex-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-5-butylsulfonylhex-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 131966530 |
| Molecular Formula | C29H44O3S |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-5-butylsulfonylhex-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@]2(C)C([C@H](C)C/C=C(\C)S(=O)(=O)CCCC)=CC[C@@H]12 |
| InChI | InChI=1S/C29H44O3S/c1-6-7-19-33(31,32)23(4)12-10-22(3)27-16-17-28-24(9-8-18-29(27,28)5)13-14-25-20-26(30)15-11-21(25)2/h12-14,16,22,26,28,30H,2,6-11,15,17-20H2,1,3-5H3/b23-12+,24-13+,25-14-/t22-,26+,28+,29-/m1/s1 |
| InChIKey | VDJQYZUMIQLXMM-POELLNKOSA-N |
| XLogP | 7.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|