C8H12N2 — CID 131966537
(1Z,3Z,5Z)-4-(methylideneamino)hepta-1,3,5-trien-1-amine (PubChem CID 131966537) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (1Z,3Z,5Z)-4-(methylideneamino)hepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5Z)-4-(methylideneamino)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 131966537 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (1Z,3Z,5Z)-4-(methylideneamino)hepta-1,3,5-trien-1-amine |
| SMILES | C=NC(/C=C\C)=C\C=C/N |
| InChI | InChI=1S/C8H12N2/c1-3-5-8(10-2)6-4-7-9/h3-7H,2,9H2,1H3/b5-3-,7-4-,8-6- |
| InChIKey | MGJHSDIGIVQMLU-CNNSZPCDSA-N |
| XLogP | 1.62 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|