C10H16N2 — CID 131966571
2-methyl-N,N'-bis[(Z)-prop-1-enyl]propane-1,3-diimine (PubChem CID 131966571) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-methyl-N,N'-bis[(Z)-prop-1-enyl]propane-1,3-diimine.
| Compound Name | 2-methyl-N,N'-bis[(Z)-prop-1-enyl]propane-1,3-diimine |
|---|---|
| PubChem CID | 131966571 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-methyl-N,N'-bis[(Z)-prop-1-enyl]propane-1,3-diimine |
| SMILES | C/C=C\N=C\C(C)/C=N/C=C\C |
| InChI | InChI=1S/C10H16N2/c1-4-6-11-8-10(3)9-12-7-5-2/h4-10H,1-3H3/b6-4-,7-5-,11-8+,12-9+ |
| InChIKey | BTSNKJUOBZNUKM-MQHORPBMSA-N |
| XLogP | 2.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|