C16H22N2 — CID 131966626
N-buta-1,3-dien-2-yl-N'-[(1Z,5Z)-4-methylhepta-1,5-dienyl]-2-methylidenepropane-1,3-diimine (PubChem CID 131966626) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N'-[(1Z,5Z)-4-methylhepta-1,5-dienyl]-2-methylidenepropane-1,3-diimine.
| Compound Name | N-buta-1,3-dien-2-yl-N'-[(1Z,5Z)-4-methylhepta-1,5-dienyl]-2-methylidenepropane-1,3-diimine |
|---|---|
| PubChem CID | 131966626 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N'-[(1Z,5Z)-4-methylhepta-1,5-dienyl]-2-methylidenepropane-1,3-diimine |
| SMILES | C=CC(=C)/N=C/C(=C)/C=N/C=C\CC(C)/C=C\C |
| InChI | InChI=1S/C16H22N2/c1-6-9-14(3)10-8-11-17-12-15(4)13-18-16(5)7-2/h6-9,11-14H,2,4-5,10H2,1,3H3/b9-6-,11-8-,17-12+,18-13+ |
| InChIKey | DIPLUFYANVAUCD-DVNUWCSASA-N |
| XLogP | 4.50 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|