About 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline
7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline (PubChem CID 131966646) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline.
Molecular Properties
| Compound Name | 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline |
| PubChem CID | 131966646 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline |
| SMILES | C1=CC2C=NC3=C(C=CN=CC3)C2C=C1 |
| InChI | InChI=1S/C13H12N2/c1-2-4-11-10(3-1)9-15-13-6-8-14-7-5-12(11)13/h1-5,7-11H,6H2 |
| InChIKey | JHMDYOZRHZMFQY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline?
The IUPAC name of 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline (CID 131966646) is 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline.
What is the SMILES notation for 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline?
The canonical SMILES for 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline is C1=CC2C=NC3=C(C=CN=CC3)C2C=C1.
What is the InChIKey of 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline?
The InChIKey is JHMDYOZRHZMFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-4-11-10(3-1)9-15-13-6-8-14-7-5-12(11)13/h1-5,7-11H,6H2.
What are the key properties of 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline?
7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline has a molecular weight of 196.25 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7a,11a-dihydro-5H-azepino[4,5-c]isoquinoline is sourced from PubChem (CID 131966646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).