About 2,6-dimethyl-8H-pyrido[2,3-c]azepine
2,6-dimethyl-8H-pyrido[2,3-c]azepine (PubChem CID 131966672) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2,6-dimethyl-8H-pyrido[2,3-c]azepine.
Molecular Properties
| Compound Name | 2,6-dimethyl-8H-pyrido[2,3-c]azepine |
| PubChem CID | 131966672 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2,6-dimethyl-8H-pyrido[2,3-c]azepine |
| SMILES | CC1=CNC=c2nc(C)ccc2=C1 |
| InChI | InChI=1S/C11H12N2/c1-8-5-10-4-3-9(2)13-11(10)7-12-6-8/h3-7,12H,1-2H3 |
| InChIKey | NWSVDGJTFUGQRX-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-8H-pyrido[2,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-8H-pyrido[2,3-c]azepine?
The IUPAC name of 2,6-dimethyl-8H-pyrido[2,3-c]azepine (CID 131966672) is 2,6-dimethyl-8H-pyrido[2,3-c]azepine.
What is the SMILES notation for 2,6-dimethyl-8H-pyrido[2,3-c]azepine?
The canonical SMILES for 2,6-dimethyl-8H-pyrido[2,3-c]azepine is CC1=CNC=c2nc(C)ccc2=C1.
What is the InChIKey of 2,6-dimethyl-8H-pyrido[2,3-c]azepine?
The InChIKey is NWSVDGJTFUGQRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-8-5-10-4-3-9(2)13-11(10)7-12-6-8/h3-7,12H,1-2H3.
What are the key properties of 2,6-dimethyl-8H-pyrido[2,3-c]azepine?
2,6-dimethyl-8H-pyrido[2,3-c]azepine has a molecular weight of 172.23 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-8H-pyrido[2,3-c]azepine is sourced from PubChem (CID 131966672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).