About 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine
2,6,9-trimethyl-8H-pyrido[2,3-c]azepine (PubChem CID 131966673) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine.
Molecular Properties
| Compound Name | 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine |
| PubChem CID | 131966673 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine |
| SMILES | CC1=CNC(C)=c2nc(C)ccc2=C1 |
| InChI | InChI=1S/C12H14N2/c1-8-6-11-5-4-9(2)14-12(11)10(3)13-7-8/h4-7,13H,1-3H3 |
| InChIKey | YGMJJIIYTBETDD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine?
The IUPAC name of 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine (CID 131966673) is 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine.
What is the SMILES notation for 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine?
The canonical SMILES for 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine is CC1=CNC(C)=c2nc(C)ccc2=C1.
What is the InChIKey of 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine?
The InChIKey is YGMJJIIYTBETDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-8-6-11-5-4-9(2)14-12(11)10(3)13-7-8/h4-7,13H,1-3H3.
What are the key properties of 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine?
2,6,9-trimethyl-8H-pyrido[2,3-c]azepine has a molecular weight of 186.26 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,9-trimethyl-8H-pyrido[2,3-c]azepine is sourced from PubChem (CID 131966673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).