C10H14N2 — CID 131966680
(Z)-6-N,3,4-trimethylidenehept-5-ene-2,6-diimine (PubChem CID 131966680) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (Z)-6-N,3,4-trimethylidenehept-5-ene-2,6-diimine.
| Compound Name | (Z)-6-N,3,4-trimethylidenehept-5-ene-2,6-diimine |
|---|---|
| PubChem CID | 131966680 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (Z)-6-N,3,4-trimethylidenehept-5-ene-2,6-diimine |
| SMILES | [H]/N=C(\C)C(=C)C(=C)/C=C(/C)N=C |
| InChI | InChI=1S/C10H14N2/c1-7(6-8(2)12-5)9(3)10(4)11/h6,11H,1,3,5H2,2,4H3/b8-6-,11-10+ |
| InChIKey | PRQLIAFOPFXYHJ-FEVLKHHISA-N |
| XLogP | 2.74 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|