C14H18N2 — CID 131966696
(2Z,5Z,8Z)-N,N'-dimethyl-4,7-dimethylidenedeca-2,5,8-triene-1,10-diimine (PubChem CID 131966696) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2Z,5Z,8Z)-N,N'-dimethyl-4,7-dimethylidenedeca-2,5,8-triene-1,10-diimine.
| Compound Name | (2Z,5Z,8Z)-N,N'-dimethyl-4,7-dimethylidenedeca-2,5,8-triene-1,10-diimine |
|---|---|
| PubChem CID | 131966696 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2Z,5Z,8Z)-N,N'-dimethyl-4,7-dimethylidenedeca-2,5,8-triene-1,10-diimine |
| SMILES | C=C(/C=C\C=N\C)/C=C\C(=C)/C=C\C=N\C |
| InChI | InChI=1S/C14H18N2/c1-13(7-5-11-15-3)9-10-14(2)8-6-12-16-4/h5-12H,1-2H2,3-4H3/b7-5-,8-6-,10-9-,15-11+,16-12+ |
| InChIKey | KWWIXTBCHFFMMG-GPNWZCJKSA-N |
| XLogP | 3.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|