C14H14N2 — CID 131966697
(2Z,5Z)-6-(1-azacyclohepta-2,3,5,7-tetraen-4-yl)-N-methyl-4-methylidenehexa-2,5-dien-1-imine (PubChem CID 131966697) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (2Z,5Z)-6-(1-azacyclohepta-2,3,5,7-tetraen-4-yl)-N-methyl-4-methylidenehexa-2,5-dien-1-imine.
| Compound Name | (2Z,5Z)-6-(1-azacyclohepta-2,3,5,7-tetraen-4-yl)-N-methyl-4-methylidenehexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 131966697 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (2Z,5Z)-6-(1-azacyclohepta-2,3,5,7-tetraen-4-yl)-N-methyl-4-methylidenehexa-2,5-dien-1-imine |
| SMILES | C=C(/C=C\C=N\C)/C=C\C1=C=CN=CC=C1 |
| InChI | InChI=1S/C14H14N2/c1-13(5-3-10-15-2)7-8-14-6-4-11-16-12-9-14/h3-8,10-12H,1H2,2H3/b5-3-,8-7-,15-10+ |
| InChIKey | IBHZAGGQROBSGF-BQUIHDBJSA-N |
| XLogP | 3.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|