C9H14N2 — CID 131966707
(Z)-2-N-ethenyl-4-N-ethylidenepent-3-ene-2,4-diimine (PubChem CID 131966707) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (Z)-2-N-ethenyl-4-N-ethylidenepent-3-ene-2,4-diimine.
| Compound Name | (Z)-2-N-ethenyl-4-N-ethylidenepent-3-ene-2,4-diimine |
|---|---|
| PubChem CID | 131966707 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (Z)-2-N-ethenyl-4-N-ethylidenepent-3-ene-2,4-diimine |
| SMILES | C=C/N=C(C)/C=C(C)\N=C\C |
| InChI | InChI=1S/C9H14N2/c1-5-10-8(3)7-9(4)11-6-2/h5-7H,1H2,2-4H3/b9-7-,10-8+,11-6+ |
| InChIKey | GBBJFHPMMRRLMP-WZXDBYQDSA-N |
| XLogP | 2.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|