C25H22F2N6O4S — CID 131966901
(3R)-N-[3-[5-(2-cyclopropylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-hydroxyphenyl]-3-fluoropyrrolidine-1-sulfonamide (PubChem CID 131966901) has the molecular formula C25H22F2N6O4S and a molecular weight of 540.55 g/mol. Its IUPAC name is (3R)-N-[3-[5-(2-cyclopropylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-hydroxyphenyl]-3-fluoropyrrolidine-1-sulfonamide.
| Compound Name | (3R)-N-[3-[5-(2-cyclopropylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-hydroxyphenyl]-3-fluoropyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 131966901 |
| Molecular Formula | C25H22F2N6O4S |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | (3R)-N-[3-[5-(2-cyclopropylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2-fluoro-4-hydroxyphenyl]-3-fluoropyrrolidine-1-sulfonamide |
| SMILES | O=C(c1c(O)ccc(NS(=O)(=O)N2CC[C@@H](F)C2)c1F)c1c[nH]c2ncc(-c3cnc(C4CC4)nc3)cc12 |
| InChI | InChI=1S/C25H22F2N6O4S/c26-16-5-6-33(12-16)38(36,37)32-19-3-4-20(34)21(22(19)27)23(35)18-11-31-25-17(18)7-14(8-30-25)15-9-28-24(29-10-15)13-1-2-13/h3-4,7-11,13,16,32,34H,1-2,5-6,12H2,(H,30,31)/t16-/m1/s1 |
| InChIKey | ZUSNKEUCQNVTSH-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|