C20H25N5 — CID 131967005
N-[[3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-5-yl)methyl]phenyl]methyl]ethanamine (PubChem CID 131967005) has the molecular formula C20H25N5 and a molecular weight of 335.46 g/mol. Its IUPAC name is N-[[3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-5-yl)methyl]phenyl]methyl]ethanamine.
| Compound Name | N-[[3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-5-yl)methyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 131967005 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-[[3-[(4,12-dimethyl-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraen-5-yl)methyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(CN2C(C)=CC3C2C=Cc2nnc(C)n23)c1 |
| InChI | InChI=1S/C20H25N5/c1-4-21-12-16-6-5-7-17(11-16)13-24-14(2)10-19-18(24)8-9-20-23-22-15(3)25(19)20/h5-11,18-19,21H,4,12-13H2,1-3H3 |
| InChIKey | GKWLOEUGNUWETA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |