C17H15F3N4 — CID 131967029
5-benzyl-12-methyl-4-(trifluoromethyl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene (PubChem CID 131967029) has the molecular formula C17H15F3N4 and a molecular weight of 332.33 g/mol. Its IUPAC name is 5-benzyl-12-methyl-4-(trifluoromethyl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene.
| Compound Name | 5-benzyl-12-methyl-4-(trifluoromethyl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene |
|---|---|
| PubChem CID | 131967029 |
| Molecular Formula | C17H15F3N4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-benzyl-12-methyl-4-(trifluoromethyl)-1,5,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,7,9,11-tetraene |
| SMILES | Cc1nnc2n1C1C=C(C(F)(F)F)N(Cc3ccccc3)C1C=C2 |
| InChI | InChI=1S/C17H15F3N4/c1-11-21-22-16-8-7-13-14(24(11)16)9-15(17(18,19)20)23(13)10-12-5-3-2-4-6-12/h2-9,13-14H,10H2,1H3 |
| InChIKey | QRIXFJHFCPNJTK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |