C14H25N — CID 131967160
(3Z)-N,5-dimethyl-3,4-di(propan-2-yl)hexa-3,5-dien-2-imine (PubChem CID 131967160) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (3Z)-N,5-dimethyl-3,4-di(propan-2-yl)hexa-3,5-dien-2-imine.
| Compound Name | (3Z)-N,5-dimethyl-3,4-di(propan-2-yl)hexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 131967160 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (3Z)-N,5-dimethyl-3,4-di(propan-2-yl)hexa-3,5-dien-2-imine |
| SMILES | C=C(C)/C(=C(C(\C)=N\C)/C(C)C)C(C)C |
| InChI | InChI=1S/C14H25N/c1-9(2)13(10(3)4)14(11(5)6)12(7)15-8/h10-11H,1H2,2-8H3/b14-13+,15-12+ |
| InChIKey | BHWFCQSZGHIPFX-RCQWFYMDSA-N |
| XLogP | 4.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|