C20H29F3N2O5 — CID 131967792
9-amino-3,10,12-trihydroxy-11-oxo-7-(trifluoromethyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a,12,12a-hexadecahydro-1H-tetracene-2-carboxamide (PubChem CID 131967792) has the molecular formula C20H29F3N2O5 and a molecular weight of 434.46 g/mol. Its IUPAC name is 9-amino-3,10,12-trihydroxy-11-oxo-7-(trifluoromethyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a,12,12a-hexadecahydro-1H-tetracene-2-carboxamide.
| Compound Name | 9-amino-3,10,12-trihydroxy-11-oxo-7-(trifluoromethyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a,12,12a-hexadecahydro-1H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 131967792 |
| Molecular Formula | C20H29F3N2O5 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 9-amino-3,10,12-trihydroxy-11-oxo-7-(trifluoromethyl)-2,3,4,4a,5,5a,6,6a,7,8,9,10,10a,11a,12,12a-hexadecahydro-1H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1CC2C(CC1O)CC1CC3C(C(=O)C1C2O)C(O)C(N)CC3C(F)(F)F |
| InChI | InChI=1S/C20H29F3N2O5/c21-20(22,23)11-5-12(24)17(28)15-9(11)2-7-1-6-3-13(26)10(19(25)30)4-8(6)16(27)14(7)18(15)29/h6-17,26-28H,1-5,24H2,(H2,25,30) |
| InChIKey | DYFHCJITYUEWBP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |