About 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol
2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol (PubChem CID 131968095) has the molecular formula C6H12N2O3S
and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol |
| PubChem CID | 131968095 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol |
| SMILES | O=S1(=O)CN2C[C@H]1CN2CCO |
| InChI | InChI=1S/C6H12N2O3S/c9-2-1-7-3-6-4-8(7)5-12(6,10)11/h6,9H,1-5H2/t6-/m1/s1 |
| InChIKey | LJFOJGXGKFNACG-ZCFIWIBFSA-N |
| XLogP | -1.73 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol?
The IUPAC name of 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol (CID 131968095) is 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol.
What is the SMILES notation for 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol?
The canonical SMILES for 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol is O=S1(=O)CN2C[C@H]1CN2CCO.
What is the InChIKey of 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol?
The InChIKey is LJFOJGXGKFNACG-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H12N2O3S/c9-2-1-7-3-6-4-8(7)5-12(6,10)11/h6,9H,1-5H2/t6-/m1/s1.
What are the key properties of 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol?
2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol has a molecular weight of 192.24 g/mol, XLogP of -1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-5,5-dioxo-5λ6-thia-1,2-diazabicyclo[2.2.1]heptan-2-yl]ethanol is sourced from PubChem (CID 131968095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).