C22H33N6O3+ — CID 131968517
2-[[(E)-[1-(2-acetamidoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]carbamoyl]-methylamino]ethyl-trimethylazanium (PubChem CID 131968517) has the molecular formula C22H33N6O3+ and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-[[(E)-[1-(2-acetamidoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]carbamoyl]-methylamino]ethyl-trimethylazanium.
| Compound Name | 2-[[(E)-[1-(2-acetamidoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]carbamoyl]-methylamino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 131968517 |
| Molecular Formula | C22H33N6O3+ |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 2-[[(E)-[1-(2-acetamidoethyl)-3-formyl-6,7-dimethylquinoxalin-2-ylidene]carbamoyl]-methylamino]ethyl-trimethylazanium |
| SMILES | CC(=O)NCCn1/c(=N/C(=O)N(C)CC[N+](C)(C)C)c(C=O)nc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C22H32N6O3/c1-15-12-18-20(13-16(15)2)27(9-8-23-17(3)30)21(19(14-29)24-18)25-22(31)26(4)10-11-28(5,6)7/h12-14H,8-11H2,1-7H3/p+1/b25-21+ |
| InChIKey | AOEDTFVOHHBPCE-NJNXFGOHSA-O |
| XLogP | 1.26 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|