C20H27FS — CID 131968624
5-[5-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)cyclohept-3-en-1-yl]hexane-2-thiol (PubChem CID 131968624) has the molecular formula C20H27FS and a molecular weight of 318.50 g/mol. Its IUPAC name is 5-[5-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)cyclohept-3-en-1-yl]hexane-2-thiol.
| Compound Name | 5-[5-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)cyclohept-3-en-1-yl]hexane-2-thiol |
|---|---|
| PubChem CID | 131968624 |
| Molecular Formula | C20H27FS |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 5-[5-(5-fluorocyclohepta-1,3,4,6-tetraen-1-yl)cyclohept-3-en-1-yl]hexane-2-thiol |
| SMILES | CC(S)CCC(C)C1CC=CC(C2=CC=C=C(F)C=C2)CC1 |
| InChI | InChI=1S/C20H27FS/c1-15(9-10-16(2)22)17-5-3-6-18(12-11-17)19-7-4-8-20(21)14-13-19/h3-4,6-7,13-18,22H,5,9-12H2,1-2H3 |
| InChIKey | GLYSSECKYWPYGE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|