C11H20F4O7P2 — CID 13196896
[(E)-1-diethoxyphosphoryl-2,3,3,3-tetrafluoroprop-1-enyl] diethyl phosphate (PubChem CID 13196896) has the molecular formula C11H20F4O7P2 and a molecular weight of 402.21 g/mol. Its IUPAC name is [(E)-1-diethoxyphosphoryl-2,3,3,3-tetrafluoroprop-1-enyl] diethyl phosphate.
| Compound Name | [(E)-1-diethoxyphosphoryl-2,3,3,3-tetrafluoroprop-1-enyl] diethyl phosphate |
|---|---|
| PubChem CID | 13196896 |
| Molecular Formula | C11H20F4O7P2 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [(E)-1-diethoxyphosphoryl-2,3,3,3-tetrafluoroprop-1-enyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(\F)C(F)(F)F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H20F4O7P2/c1-5-18-23(16,19-6-2)10(9(12)11(13,14)15)22-24(17,20-7-3)21-8-4/h5-8H2,1-4H3/b10-9+ |
| InChIKey | DTKFLJHYGKAASD-MDZDMXLPSA-N |
| XLogP | 5.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|