C28H46N4 — CID 131968993
8-[3-[but-3-enyl(propyl)amino]propyl]-4-[1-(dipropylamino)ethenyl]-9,9a-dihydro-3H-1-benzazepin-2-amine (PubChem CID 131968993) has the molecular formula C28H46N4 and a molecular weight of 438.70 g/mol. Its IUPAC name is 8-[3-[but-3-enyl(propyl)amino]propyl]-4-[1-(dipropylamino)ethenyl]-9,9a-dihydro-3H-1-benzazepin-2-amine.
| Compound Name | 8-[3-[but-3-enyl(propyl)amino]propyl]-4-[1-(dipropylamino)ethenyl]-9,9a-dihydro-3H-1-benzazepin-2-amine |
|---|---|
| PubChem CID | 131968993 |
| Molecular Formula | C28H46N4 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | 8-[3-[but-3-enyl(propyl)amino]propyl]-4-[1-(dipropylamino)ethenyl]-9,9a-dihydro-3H-1-benzazepin-2-amine |
| SMILES | C=CCCN(CCC)CCCC1=CC=C2C=C(C(=C)N(CCC)CCC)CC(N)=NC2C1 |
| InChI | InChI=1S/C28H46N4/c1-6-10-18-31(15-7-2)19-11-12-24-13-14-25-21-26(22-28(29)30-27(25)20-24)23(5)32(16-8-3)17-9-4/h6,13-14,21,27H,1,5,7-12,15-20,22H2,2-4H3,(H2,29,30) |
| InChIKey | KBLBEEFPEADDHX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|