C8H11F6O3P — CID 13196904
(Z)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-ene (PubChem CID 13196904) has the molecular formula C8H11F6O3P and a molecular weight of 300.14 g/mol. Its IUPAC name is (Z)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-ene.
| Compound Name | (Z)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-ene |
|---|---|
| PubChem CID | 13196904 |
| Molecular Formula | C8H11F6O3P |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (Z)-1-diethoxyphosphoryl-2,3,3,4,4,4-hexafluorobut-1-ene |
| SMILES | CCOP(=O)(/C=C(\F)C(F)(F)C(F)(F)F)OCC |
| InChI | InChI=1S/C8H11F6O3P/c1-3-16-18(15,17-4-2)5-6(9)7(10,11)8(12,13)14/h5H,3-4H2,1-2H3/b6-5- |
| InChIKey | XBPLYRXYVOEMCT-WAYWQWQTSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|