C29H38N6O4 — CID 131969060
2-methylpropyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate (PubChem CID 131969060) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-methylpropyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate.
| Compound Name | 2-methylpropyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate |
|---|---|
| PubChem CID | 131969060 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 2-methylpropyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate |
| SMILES | CCCN(CCCN=O)C(=O)C1=Cc2ccc(-c3ccc(CC(=O)OCC(C)C)cc3)cc2NC(N=NN)C1 |
| InChI | InChI=1S/C29H38N6O4/c1-4-13-35(14-5-12-31-38)29(37)25-16-24-11-10-23(17-26(24)32-27(18-25)33-34-30)22-8-6-21(7-9-22)15-28(36)39-19-20(2)3/h6-11,16-17,20,27,32H,4-5,12-15,18-19H2,1-3H3,(H2,30,33) |
| InChIKey | HTODDKYXICFOLA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|