About (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal
(3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal (PubChem CID 131969420) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal.
Molecular Properties
| Compound Name | (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal |
| PubChem CID | 131969420 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal |
| SMILES | C=C/C=C\C(=C/C)C(C=O)OC |
| InChI | InChI=1S/C10H14O2/c1-4-6-7-9(5-2)10(8-11)12-3/h4-8,10H,1H2,2-3H3/b7-6-,9-5+ |
| InChIKey | CIXYBEFZHCQCEE-QRLJIZSYSA-N |
| XLogP | 1.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal?
The IUPAC name of (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal (CID 131969420) is (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal.
What is the SMILES notation for (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal?
The canonical SMILES for (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal is C=C/C=C\C(=C/C)C(C=O)OC.
What is the InChIKey of (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal?
The InChIKey is CIXYBEFZHCQCEE-QRLJIZSYSA-N. The full InChI is InChI=1S/C10H14O2/c1-4-6-7-9(5-2)10(8-11)12-3/h4-8,10H,1H2,2-3H3/b7-6-,9-5+.
What are the key properties of (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal?
(3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal has a molecular weight of 166.22 g/mol, XLogP of 1.89, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-3-ethylidene-2-methoxyhepta-4,6-dienal is sourced from PubChem (CID 131969420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).