C11H10F9N — CID 13196957
1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]piperidine (PubChem CID 13196957) has the molecular formula C11H10F9N and a molecular weight of 327.19 g/mol. Its IUPAC name is 1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]piperidine.
| Compound Name | 1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]piperidine |
|---|---|
| PubChem CID | 13196957 |
| Molecular Formula | C11H10F9N |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-[3,3,4,4,5,5-hexafluoro-2-(trifluoromethyl)cyclopenten-1-yl]piperidine |
| SMILES | FC(F)(F)C1=C(N2CCCCC2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H10F9N/c12-8(13)6(10(16,17)18)7(9(14,15)11(8,19)20)21-4-2-1-3-5-21/h1-5H2 |
| InChIKey | XUHBJWTWGTWOKR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|