C20H23N3 — CID 131969772
2-methyl-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]-6-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,3,5-triazine (PubChem CID 131969772) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-methyl-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]-6-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,3,5-triazine.
| Compound Name | 2-methyl-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]-6-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 131969772 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-methyl-4-[(2Z,4E)-octa-2,4,6,7-tetraen-4-yl]-6-[(3E,5Z)-octa-3,5,7-trien-4-yl]-1,3,5-triazine |
| SMILES | C=C=C/C=C(\C=C/C)c1nc(C)nc(C(/C=C\C=C)=C/CC)n1 |
| InChI | InChI=1S/C20H23N3/c1-6-10-14-17(12-8-3)19-21-16(5)22-20(23-19)18(13-9-4)15-11-7-2/h6,9-15H,1-2,8H2,3-5H3/b13-9-,14-10-,17-12+,18-15+ |
| InChIKey | WIUSSROLOCIBFI-ZQUGDGRSSA-N |
| XLogP | 5.02 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|