About 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol
2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol (PubChem CID 131969872) has the molecular formula C18H15Br3O3
and a molecular weight of 519.03 g/mol. Its IUPAC name is 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol |
| PubChem CID | 131969872 |
| Molecular Formula | C18H15Br3O3 |
| Molecular Weight | 519.03 g/mol |
| Exact Mass | 515.86 |
| IUPAC Name | 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol |
| SMILES | OCCOCCOc1cc(Br)c2c(Br)c3c(Br)cccc3cc2c1 |
| InChI | InChI=1S/C18H15Br3O3/c19-14-3-1-2-11-8-12-9-13(24-7-6-23-5-4-22)10-15(20)17(12)18(21)16(11)14/h1-3,8-10,22H,4-7H2 |
| InChIKey | DVFWOKASPZONCL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.03 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol?
The IUPAC name of 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol (CID 131969872) is 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol.
What is the SMILES notation for 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol?
The canonical SMILES for 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol is OCCOCCOc1cc(Br)c2c(Br)c3c(Br)cccc3cc2c1.
What is the InChIKey of 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol?
The InChIKey is DVFWOKASPZONCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Br3O3/c19-14-3-1-2-11-8-12-9-13(24-7-6-23-5-4-22)10-15(20)17(12)18(21)16(11)14/h1-3,8-10,22H,4-7H2.
What are the key properties of 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol?
2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol has a molecular weight of 519.03 g/mol, XLogP of 5.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,5,10-tribromoanthracen-2-yl)oxyethoxy]ethanol is sourced from PubChem (CID 131969872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).