About (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane
(8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane (PubChem CID 131969943) has the molecular formula C18H18BrNS
and a molecular weight of 360.32 g/mol. Its IUPAC name is (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane |
| PubChem CID | 131969943 |
| Molecular Formula | C18H18BrNS |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane |
| SMILES | CS(C)(C)n1c2c(c3cc(Br)ccc31)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H18BrNS/c1-21(2,3)20-17-9-8-13(19)11-15(17)16-10-12-6-4-5-7-14(12)18(16)20/h4-9,11H,10H2,1-3H3 |
| InChIKey | CNGNOWXGKFTFJH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane?
The IUPAC name of (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane (CID 131969943) is (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane.
What is the SMILES notation for (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane?
The canonical SMILES for (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane is CS(C)(C)n1c2c(c3cc(Br)ccc31)Cc1ccccc1-2.
What is the InChIKey of (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane?
The InChIKey is CNGNOWXGKFTFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrNS/c1-21(2,3)20-17-9-8-13(19)11-15(17)16-10-12-6-4-5-7-14(12)18(16)20/h4-9,11H,10H2,1-3H3.
What are the key properties of (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane?
(8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane has a molecular weight of 360.32 g/mol, XLogP of 5.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8-bromo-10H-indeno[1,2-b]indol-5-yl)-trimethyl-λ4-sulfane is sourced from PubChem (CID 131969943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).