About 4,7-dihydro-1H-purine-2,6-diamine
4,7-dihydro-1H-purine-2,6-diamine (PubChem CID 131970278) has the molecular formula C5H8N6
and a molecular weight of 152.16 g/mol. Its IUPAC name is 4,7-dihydro-1H-purine-2,6-diamine.
Molecular Properties
| Compound Name | 4,7-dihydro-1H-purine-2,6-diamine |
| PubChem CID | 131970278 |
| Molecular Formula | C5H8N6 |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4,7-dihydro-1H-purine-2,6-diamine |
| SMILES | NC1=NC2N=CNC2=C(N)N1 |
| InChI | InChI=1S/C5H8N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1,4H,6H2,(H,8,9)(H3,7,10,11) |
| InChIKey | SPAYIJFAUABIGA-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,7-dihydro-1H-purine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-1H-purine-2,6-diamine?
The IUPAC name of 4,7-dihydro-1H-purine-2,6-diamine (CID 131970278) is 4,7-dihydro-1H-purine-2,6-diamine.
What is the SMILES notation for 4,7-dihydro-1H-purine-2,6-diamine?
The canonical SMILES for 4,7-dihydro-1H-purine-2,6-diamine is NC1=NC2N=CNC2=C(N)N1.
What is the InChIKey of 4,7-dihydro-1H-purine-2,6-diamine?
The InChIKey is SPAYIJFAUABIGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1,4H,6H2,(H,8,9)(H3,7,10,11).
What are the key properties of 4,7-dihydro-1H-purine-2,6-diamine?
4,7-dihydro-1H-purine-2,6-diamine has a molecular weight of 152.16 g/mol, XLogP of -2.01, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-1H-purine-2,6-diamine is sourced from PubChem (CID 131970278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).