C5H9N5 — CID 131970281
4,7,8,9-tetrahydro-1H-purin-6-amine (PubChem CID 131970281) has the molecular formula C5H9N5 and a molecular weight of 139.16 g/mol. Its IUPAC name is 4,7,8,9-tetrahydro-1H-purin-6-amine.
| Compound Name | 4,7,8,9-tetrahydro-1H-purin-6-amine |
|---|---|
| PubChem CID | 131970281 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 4,7,8,9-tetrahydro-1H-purin-6-amine |
| SMILES | NC1=C2NCNC2N=CN1 |
| InChI | InChI=1S/C5H9N5/c6-4-3-5(9-1-7-3)10-2-8-4/h2,5,7,9H,1,6H2,(H,8,10) |
| InChIKey | WOUXZWCUFYWDDQ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |