C9H17N3O — CID 131970318
N-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2,2-dimethylpropanamide (PubChem CID 131970318) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 131970318 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-[(1E,3Z)-1,4-diaminobuta-1,3-dien-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(/C=C\N)=C/N |
| InChI | InChI=1S/C9H17N3O/c1-9(2,3)8(13)12-7(6-11)4-5-10/h4-6H,10-11H2,1-3H3,(H,12,13)/b5-4-,7-6+ |
| InChIKey | QCLUSADIQRMKAJ-SCFJQAPRSA-N |
| XLogP | 0.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|