About 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid
2-amino-4-(1,4-dioxepan-5-yl)butanoic acid (PubChem CID 131970321) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid |
| PubChem CID | 131970321 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid |
| SMILES | NC(CCC1CCOCCO1)C(=O)O |
| InChI | InChI=1S/C9H17NO4/c10-8(9(11)12)2-1-7-3-4-13-5-6-14-7/h7-8H,1-6,10H2,(H,11,12) |
| InChIKey | GFQQPAHKEGFWOU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
The IUPAC name of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid (CID 131970321) is 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid.
What is the SMILES notation for 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
The canonical SMILES for 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid is NC(CCC1CCOCCO1)C(=O)O.
What is the InChIKey of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
The InChIKey is GFQQPAHKEGFWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c10-8(9(11)12)2-1-7-3-4-13-5-6-14-7/h7-8H,1-6,10H2,(H,11,12).
What are the key properties of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
2-amino-4-(1,4-dioxepan-5-yl)butanoic acid has a molecular weight of 203.24 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid is sourced from PubChem (CID 131970321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).