2-amino-4-(1,4-dioxepan-5-yl)butanoic acid

C9H17NO4 — CID 131970321

IUPAC2-amino-4-(1,4-dioxepan-5-yl)butanoic acid
SMILESNC(CCC1CCOCCO1)C(=O)O
InChIInChI=1S/C9H17NO4/c10-8(9(11)12)2-1-7-3-4-13-5-6-14-7/h7-8H,1-6,10H2,(H,11,12)
InChIKeyGFQQPAHKEGFWOU-UHFFFAOYSA-N
MW203.24 g/mol
LogP-0.02
Rot. Bonds4

About 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid

2-amino-4-(1,4-dioxepan-5-yl)butanoic acid (PubChem CID 131970321) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid.

Molecular Properties

Compound Name2-amino-4-(1,4-dioxepan-5-yl)butanoic acid
PubChem CID131970321
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Name2-amino-4-(1,4-dioxepan-5-yl)butanoic acid
SMILESNC(CCC1CCOCCO1)C(=O)O
InChIInChI=1S/C9H17NO4/c10-8(9(11)12)2-1-7-3-4-13-5-6-14-7/h7-8H,1-6,10H2,(H,11,12)
InChIKeyGFQQPAHKEGFWOU-UHFFFAOYSA-N
XLogP-0.02
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
The IUPAC name of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid (CID 131970321) is 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid.
What is the SMILES notation for 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
The canonical SMILES for 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid is NC(CCC1CCOCCO1)C(=O)O.
What is the InChIKey of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
The InChIKey is GFQQPAHKEGFWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c10-8(9(11)12)2-1-7-3-4-13-5-6-14-7/h7-8H,1-6,10H2,(H,11,12).
What are the key properties of 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid?
2-amino-4-(1,4-dioxepan-5-yl)butanoic acid has a molecular weight of 203.24 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(1,4-dioxepan-5-yl)butanoic acid is sourced from PubChem (CID 131970321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).