About 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile
2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile (PubChem CID 131970438) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile |
| PubChem CID | 131970438 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile |
| SMILES | N#CC1=CNC(NC2CCC2)C=C1 |
| InChI | InChI=1S/C10H13N3/c11-6-8-4-5-10(12-7-8)13-9-2-1-3-9/h4-5,7,9-10,12-13H,1-3H2 |
| InChIKey | HLVOIYVMLZCRAL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile?
The IUPAC name of 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile (CID 131970438) is 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile.
What is the SMILES notation for 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile?
The canonical SMILES for 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile is N#CC1=CNC(NC2CCC2)C=C1.
What is the InChIKey of 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile?
The InChIKey is HLVOIYVMLZCRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c11-6-8-4-5-10(12-7-8)13-9-2-1-3-9/h4-5,7,9-10,12-13H,1-3H2.
What are the key properties of 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile?
2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile has a molecular weight of 175.24 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclobutylamino)-1,2-dihydropyridine-5-carbonitrile is sourced from PubChem (CID 131970438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).