C27H34FN5O2S — CID 131971055
6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(propylamino)-N-[[6-(propylamino)-2-pyridinyl]sulfanyl]pyridine-3-carboxamide (PubChem CID 131971055) has the molecular formula C27H34FN5O2S and a molecular weight of 511.67 g/mol. Its IUPAC name is 6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(propylamino)-N-[[6-(propylamino)-2-pyridinyl]sulfanyl]pyridine-3-carboxamide.
| Compound Name | 6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(propylamino)-N-[[6-(propylamino)-2-pyridinyl]sulfanyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 131971055 |
| Molecular Formula | C27H34FN5O2S |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(propylamino)-N-[[6-(propylamino)-2-pyridinyl]sulfanyl]pyridine-3-carboxamide |
| SMILES | CCCNc1cccc(SNC(=O)c2ccc(-c3cc(F)cc(OCC(C)C)c3)nc2NCCC)n1 |
| InChI | InChI=1S/C27H34FN5O2S/c1-5-12-29-24-8-7-9-25(32-24)36-33-27(34)22-10-11-23(31-26(22)30-13-6-2)19-14-20(28)16-21(15-19)35-17-18(3)4/h7-11,14-16,18H,5-6,12-13,17H2,1-4H3,(H,29,32)(H,30,31)(H,33,34) |
| InChIKey | WXWRPHZZSDLYHV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|