C32H28O6 — CID 131971259
(1S,3S,7S,9R)-5,5,11,11-tetraphenyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol (PubChem CID 131971259) has the molecular formula C32H28O6 and a molecular weight of 508.57 g/mol. Its IUPAC name is (1S,3S,7S,9R)-5,5,11,11-tetraphenyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol.
| Compound Name | (1S,3S,7S,9R)-5,5,11,11-tetraphenyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol |
|---|---|
| PubChem CID | 131971259 |
| Molecular Formula | C32H28O6 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (1S,3S,7S,9R)-5,5,11,11-tetraphenyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol |
| SMILES | OC1[C@H]2OC(c3ccccc3)(c3ccccc3)O[C@H]2C(O)[C@@H]2OC(c3ccccc3)(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C32H28O6/c33-25-27-28(36-31(35-27,21-13-5-1-6-14-21)22-15-7-2-8-16-22)26(34)30-29(25)37-32(38-30,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-30,33-34H/t25?,26?,27-,28-,29-,30+/m0/s1 |
| InChIKey | IDBKXFHCZZSKDQ-CSXACLAXSA-N |
| XLogP | 4.09 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |