C16H24O6S2 — CID 131971297
(1S,3R,7S,9S)-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol (PubChem CID 131971297) has the molecular formula C16H24O6S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (1S,3R,7S,9S)-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol.
| Compound Name | (1S,3R,7S,9S)-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol |
|---|---|
| PubChem CID | 131971297 |
| Molecular Formula | C16H24O6S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (1S,3R,7S,9S)-5,11-bis(thiolan-2-yl)-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol |
| SMILES | OC1[C@H]2OC(C3CCCS3)O[C@H]2C(O)[C@@H]2OC(C3CCCS3)O[C@@H]12 |
| InChI | InChI=1S/C16H24O6S2/c17-9-11-12(20-15(19-11)7-3-1-5-23-7)10(18)14-13(9)21-16(22-14)8-4-2-6-24-8/h7-18H,1-6H2/t7?,8?,9?,10?,11-,12-,13-,14+,15?,16?/m0/s1 |
| InChIKey | LFGZWMPTZGZAAB-XCUMZDTHSA-N |
| XLogP | 0.73 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |