C10H15N — CID 131972037
(4aR)-3-methyl-1,4,4a,5,6,7-hexahydroisoquinoline (PubChem CID 131972037) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (4aR)-3-methyl-1,4,4a,5,6,7-hexahydroisoquinoline.
| Compound Name | (4aR)-3-methyl-1,4,4a,5,6,7-hexahydroisoquinoline |
|---|---|
| PubChem CID | 131972037 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (4aR)-3-methyl-1,4,4a,5,6,7-hexahydroisoquinoline |
| SMILES | CC1=NCC2=CCCC[C@@H]2C1 |
| InChI | InChI=1S/C10H15N/c1-8-6-9-4-2-3-5-10(9)7-11-8/h5,9H,2-4,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | SZPNWFVMZCBPPV-SECBINFHSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|