C30H36O7 — CID 131972240
1-O-(anthracen-1-ylmethyl) 3-O-ethyl 5-O-(hydroxymethyl) 1,5-dimethylheptane-1,3,5-tricarboxylate (PubChem CID 131972240) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is 1-O-(anthracen-1-ylmethyl) 3-O-ethyl 5-O-(hydroxymethyl) 1,5-dimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(anthracen-1-ylmethyl) 3-O-ethyl 5-O-(hydroxymethyl) 1,5-dimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 131972240 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 1-O-(anthracen-1-ylmethyl) 3-O-ethyl 5-O-(hydroxymethyl) 1,5-dimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCOC(=O)C(CC(C)C(=O)OCc1cccc2cc3ccccc3cc12)CC(C)(CC)C(=O)OCO |
| InChI | InChI=1S/C30H36O7/c1-5-30(4,29(34)37-19-31)17-25(28(33)35-6-2)14-20(3)27(32)36-18-24-13-9-12-23-15-21-10-7-8-11-22(21)16-26(23)24/h7-13,15-16,20,25,31H,5-6,14,17-19H2,1-4H3 |
| InChIKey | WVRSXUHYSHHJGH-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|