C13H22O3 — CID 131972310
7-oxabicyclo[4.1.0]heptan-2-ylmethyl 2,2-dimethylbutanoate (PubChem CID 131972310) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-2-ylmethyl 2,2-dimethylbutanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-2-ylmethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 131972310 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-2-ylmethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCCC2OC12 |
| InChI | InChI=1S/C13H22O3/c1-4-13(2,3)12(14)15-8-9-6-5-7-10-11(9)16-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | PAVOGZANKMDVIA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|