About 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane
1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane (PubChem CID 131972630) has the molecular formula C14H30O3S
and a molecular weight of 278.46 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane.
Molecular Properties
| Compound Name | 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane |
| PubChem CID | 131972630 |
| Molecular Formula | C14H30O3S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane |
| SMILES | CC(C)(C)CCS(=O)(=O)CCCOCC(C)(C)C |
| InChI | InChI=1S/C14H30O3S/c1-13(2,3)8-11-18(15,16)10-7-9-17-12-14(4,5)6/h7-12H2,1-6H3 |
| InChIKey | AKUVYYAPVQFKQA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane?
The IUPAC name of 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane (CID 131972630) is 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane.
What is the SMILES notation for 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane?
The canonical SMILES for 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane is CC(C)(C)CCS(=O)(=O)CCCOCC(C)(C)C.
What is the InChIKey of 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane?
The InChIKey is AKUVYYAPVQFKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O3S/c1-13(2,3)8-11-18(15,16)10-7-9-17-12-14(4,5)6/h7-12H2,1-6H3.
What are the key properties of 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane?
1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane has a molecular weight of 278.46 g/mol, XLogP of 3.29, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutane is sourced from PubChem (CID 131972630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).