C6H5F9O2 — CID 131973030
1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(1,1,2-trifluoroethoxy)ethane (PubChem CID 131973030) has the molecular formula C6H5F9O2 and a molecular weight of 280.09 g/mol. Its IUPAC name is 1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(1,1,2-trifluoroethoxy)ethane.
| Compound Name | 1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(1,1,2-trifluoroethoxy)ethane |
|---|---|
| PubChem CID | 131973030 |
| Molecular Formula | C6H5F9O2 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1-(1,1-difluoroethoxy)-1,1,2,2-tetrafluoro-2-(1,1,2-trifluoroethoxy)ethane |
| SMILES | CC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)CF |
| InChI | InChI=1S/C6H5F9O2/c1-3(8,9)16-5(12,13)6(14,15)17-4(10,11)2-7/h2H2,1H3 |
| InChIKey | HTEGLKFQFHGTMA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|