C9H14O3 — CID 131973068
2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carbaldehyde (PubChem CID 131973068) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carbaldehyde.
| Compound Name | 2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carbaldehyde |
|---|---|
| PubChem CID | 131973068 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carbaldehyde |
| SMILES | COC1CC2CC(C=O)CC2O1 |
| InChI | InChI=1S/C9H14O3/c1-11-9-4-7-2-6(5-10)3-8(7)12-9/h5-9H,2-4H2,1H3 |
| InChIKey | TXEBGEVJBJJEMH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|