C25H29N7O — CID 131973222
6-[3-[(2-aminoethylamino)methyl]phenyl]-1-propan-2-yl-N-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 131973222) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 6-[3-[(2-aminoethylamino)methyl]phenyl]-1-propan-2-yl-N-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-[3-[(2-aminoethylamino)methyl]phenyl]-1-propan-2-yl-N-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 131973222 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 6-[3-[(2-aminoethylamino)methyl]phenyl]-1-propan-2-yl-N-(pyridin-4-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)n1ncc2c(C(=O)NCc3ccncc3)cc(-c3cccc(CNCCN)c3)nc21 |
| InChI | InChI=1S/C25H29N7O/c1-17(2)32-24-22(16-30-32)21(25(33)29-15-18-6-9-27-10-7-18)13-23(31-24)20-5-3-4-19(12-20)14-28-11-8-26/h3-7,9-10,12-13,16-17,28H,8,11,14-15,26H2,1-2H3,(H,29,33) |
| InChIKey | XVOBJLDXPTYWNI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|