C14H20N2O — CID 13197377
1,2,3,4,6,7,8,9,10,11-decahydroazocino[2,1-b]quinazolin-13-one (PubChem CID 13197377) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1,2,3,4,6,7,8,9,10,11-decahydroazocino[2,1-b]quinazolin-13-one.
| Compound Name | 1,2,3,4,6,7,8,9,10,11-decahydroazocino[2,1-b]quinazolin-13-one |
|---|---|
| PubChem CID | 13197377 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1,2,3,4,6,7,8,9,10,11-decahydroazocino[2,1-b]quinazolin-13-one |
| SMILES | O=c1c2c(nc3n1CCCCCC3)CCCC2 |
| InChI | InChI=1S/C14H20N2O/c17-14-11-7-4-5-8-12(11)15-13-9-3-1-2-6-10-16(13)14/h1-10H2 |
| InChIKey | WCFODMJXNQITOI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |