C15H26O2 — CID 131974223
(E)-3-ethyl-3,8,8-trimethyldec-5-ene-4,7-dione (PubChem CID 131974223) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (E)-3-ethyl-3,8,8-trimethyldec-5-ene-4,7-dione.
| Compound Name | (E)-3-ethyl-3,8,8-trimethyldec-5-ene-4,7-dione |
|---|---|
| PubChem CID | 131974223 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (E)-3-ethyl-3,8,8-trimethyldec-5-ene-4,7-dione |
| SMILES | CCC(C)(C)C(=O)/C=C/C(=O)C(C)(CC)CC |
| InChI | InChI=1S/C15H26O2/c1-7-14(4,5)12(16)10-11-13(17)15(6,8-2)9-3/h10-11H,7-9H2,1-6H3/b11-10+ |
| InChIKey | NITACBFKVNLCQB-ZHACJKMWSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|