C14H24O2 — CID 131974233
(Z)-3,3,8,8-tetramethyldec-5-ene-4,7-dione (PubChem CID 131974233) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (Z)-3,3,8,8-tetramethyldec-5-ene-4,7-dione.
| Compound Name | (Z)-3,3,8,8-tetramethyldec-5-ene-4,7-dione |
|---|---|
| PubChem CID | 131974233 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (Z)-3,3,8,8-tetramethyldec-5-ene-4,7-dione |
| SMILES | CCC(C)(C)C(=O)/C=C\C(=O)C(C)(C)CC |
| InChI | InChI=1S/C14H24O2/c1-7-13(3,4)11(15)9-10-12(16)14(5,6)8-2/h9-10H,7-8H2,1-6H3/b10-9- |
| InChIKey | GGQPRSSTHZHHJX-KTKRTIGZSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|