About 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine
4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine (PubChem CID 131974279) has the molecular formula C9H14F3NO2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine.
Molecular Properties
| Compound Name | 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine |
| PubChem CID | 131974279 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine |
| SMILES | C=CCOC(F)(F)C(F)N1CCOCC1 |
| InChI | InChI=1S/C9H14F3NO2/c1-2-5-15-9(11,12)8(10)13-3-6-14-7-4-13/h2,8H,1,3-7H2 |
| InChIKey | LSFKUUCWVGKEOL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine?
The IUPAC name of 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine (CID 131974279) is 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine.
What is the SMILES notation for 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine?
The canonical SMILES for 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine is C=CCOC(F)(F)C(F)N1CCOCC1.
What is the InChIKey of 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine?
The InChIKey is LSFKUUCWVGKEOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2/c1-2-5-15-9(11,12)8(10)13-3-6-14-7-4-13/h2,8H,1,3-7H2.
What are the key properties of 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine?
4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine has a molecular weight of 225.21 g/mol, XLogP of 1.41, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,2-trifluoro-2-prop-2-enoxyethyl)morpholine is sourced from PubChem (CID 131974279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).