C24H24ClN7O3 — CID 131974316
(6E)-N-[2-[5-chloro-2-(tetrazol-1-yl)phenyl]ethyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carboxamide (PubChem CID 131974316) has the molecular formula C24H24ClN7O3 and a molecular weight of 493.96 g/mol. Its IUPAC name is (6E)-N-[2-[5-chloro-2-(tetrazol-1-yl)phenyl]ethyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carboxamide.
| Compound Name | (6E)-N-[2-[5-chloro-2-(tetrazol-1-yl)phenyl]ethyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carboxamide |
|---|---|
| PubChem CID | 131974316 |
| Molecular Formula | C24H24ClN7O3 |
| Molecular Weight | 493.96 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (6E)-N-[2-[5-chloro-2-(tetrazol-1-yl)phenyl]ethyl]-3,11-dioxo-2,10-diazabicyclo[10.4.0]hexadeca-1(16),6,12,14-tetraene-9-carboxamide |
| SMILES | O=C1CC/C=C/CC(C(=O)NCCc2cc(Cl)ccc2-n2cnnn2)NC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C24H24ClN7O3/c25-17-10-11-21(32-15-27-30-31-32)16(14-17)12-13-26-24(35)20-8-2-1-3-9-22(33)28-19-7-5-4-6-18(19)23(34)29-20/h1-2,4-7,10-11,14-15,20H,3,8-9,12-13H2,(H,26,35)(H,28,33)(H,29,34)/b2-1+ |
| InChIKey | UDJKQCZYNZIIJX-OWOJBTEDSA-N |
| XLogP | 2.45 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.96 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|