About 3-hydroxy-N,N-dimethylbutanamide
3-hydroxy-N,N-dimethylbutanamide (PubChem CID 13197444) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,N-dimethylbutanamide |
| PubChem CID | 13197444 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-hydroxy-N,N-dimethylbutanamide |
| SMILES | CC(O)CC(=O)N(C)C |
| InChI | InChI=1S/C6H13NO2/c1-5(8)4-6(9)7(2)3/h5,8H,4H2,1-3H3 |
| InChIKey | OHICCAZEETWRET-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,N-dimethylbutanamide?
The IUPAC name of 3-hydroxy-N,N-dimethylbutanamide (CID 13197444) is 3-hydroxy-N,N-dimethylbutanamide.
What is the SMILES notation for 3-hydroxy-N,N-dimethylbutanamide?
The canonical SMILES for 3-hydroxy-N,N-dimethylbutanamide is CC(O)CC(=O)N(C)C.
What is the InChIKey of 3-hydroxy-N,N-dimethylbutanamide?
The InChIKey is OHICCAZEETWRET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-5(8)4-6(9)7(2)3/h5,8H,4H2,1-3H3.
What are the key properties of 3-hydroxy-N,N-dimethylbutanamide?
3-hydroxy-N,N-dimethylbutanamide has a molecular weight of 131.17 g/mol, XLogP of -0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,N-dimethylbutanamide is sourced from PubChem (CID 13197444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).