C21H23NO6 — CID 131974476
(4S)-4-(3,4-dimethoxyphenyl)-3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 131974476) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (4S)-4-(3,4-dimethoxyphenyl)-3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | (4S)-4-(3,4-dimethoxyphenyl)-3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 131974476 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (4S)-4-(3,4-dimethoxyphenyl)-3-methylidene-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | C=C1C(=O)N(c2cc(OC)c(OC)c(OC)c2)[C@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H23NO6/c1-12-19(13-7-8-15(24-2)16(9-13)25-3)22(21(12)23)14-10-17(26-4)20(28-6)18(11-14)27-5/h7-11,19H,1H2,2-6H3/t19-/m1/s1 |
| InChIKey | YAXSICBLXBDINR-LJQANCHMSA-N |
| XLogP | 3.37 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|